About 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane
3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane (PubChem CID 70895234) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane |
| PubChem CID | 70895234 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane |
| SMILES | CCC(C)C1COC2(CCOCC2)OC1 |
| InChI | InChI=1S/C12H22O3/c1-3-10(2)11-8-14-12(15-9-11)4-6-13-7-5-12/h10-11H,3-9H2,1-2H3 |
| InChIKey | YZRZEOUCVHNYCS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane?
The IUPAC name of 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane (CID 70895234) is 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane.
What is the SMILES notation for 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane?
The canonical SMILES for 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane is CCC(C)C1COC2(CCOCC2)OC1.
What is the InChIKey of 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane?
The InChIKey is YZRZEOUCVHNYCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-3-10(2)11-8-14-12(15-9-11)4-6-13-7-5-12/h10-11H,3-9H2,1-2H3.
What are the key properties of 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane?
3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane has a molecular weight of 214.30 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-1,5,9-trioxaspiro[5.5]undecane is sourced from PubChem (CID 70895234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).