About 2-(4-methoxyphenyl)-9,9-dimethylfluorene
2-(4-methoxyphenyl)-9,9-dimethylfluorene (PubChem CID 70895594) has the molecular formula C22H20O
and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-9,9-dimethylfluorene.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-9,9-dimethylfluorene |
| PubChem CID | 70895594 |
| Molecular Formula | C22H20O |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-(4-methoxyphenyl)-9,9-dimethylfluorene |
| SMILES | COc1ccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C22H20O/c1-22(2)20-7-5-4-6-18(20)19-13-10-16(14-21(19)22)15-8-11-17(23-3)12-9-15/h4-14H,1-3H3 |
| InChIKey | SGNGDTYWIBDJLC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-methoxyphenyl)-9,9-dimethylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-9,9-dimethylfluorene?
The IUPAC name of 2-(4-methoxyphenyl)-9,9-dimethylfluorene (CID 70895594) is 2-(4-methoxyphenyl)-9,9-dimethylfluorene.
What is the SMILES notation for 2-(4-methoxyphenyl)-9,9-dimethylfluorene?
The canonical SMILES for 2-(4-methoxyphenyl)-9,9-dimethylfluorene is COc1ccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)-9,9-dimethylfluorene?
The InChIKey is SGNGDTYWIBDJLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O/c1-22(2)20-7-5-4-6-18(20)19-13-10-16(14-21(19)22)15-8-11-17(23-3)12-9-15/h4-14H,1-3H3.
What are the key properties of 2-(4-methoxyphenyl)-9,9-dimethylfluorene?
2-(4-methoxyphenyl)-9,9-dimethylfluorene has a molecular weight of 300.40 g/mol, XLogP of 5.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-9,9-dimethylfluorene is sourced from PubChem (CID 70895594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).