About 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one
8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 70895729) has the molecular formula C24H19N5O3S
and a molecular weight of 457.52 g/mol. Its IUPAC name is 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 70895729 |
| Molecular Formula | C24H19N5O3S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1ccc(S(=O)(=O)c2cc3cnc(Nc4ccc5ncccc5c4)nc3n(C)c2=O)cc1 |
| InChI | InChI=1S/C24H19N5O3S/c1-15-5-8-19(9-6-15)33(31,32)21-13-17-14-26-24(28-22(17)29(2)23(21)30)27-18-7-10-20-16(12-18)4-3-11-25-20/h3-14H,1-2H3,(H,26,27,28) |
| InChIKey | FRDWBACKDPUPOH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one (CID 70895729) is 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one is Cc1ccc(S(=O)(=O)c2cc3cnc(Nc4ccc5ncccc5c4)nc3n(C)c2=O)cc1.
What is the InChIKey of 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is FRDWBACKDPUPOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N5O3S/c1-15-5-8-19(9-6-15)33(31,32)21-13-17-14-26-24(28-22(17)29(2)23(21)30)27-18-7-10-20-16(12-18)4-3-11-25-20/h3-14H,1-2H3,(H,26,27,28).
What are the key properties of 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one?
8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 457.52 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-6-(4-methylphenyl)sulfonyl-2-(quinolin-6-ylamino)pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 70895729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).