About 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride
1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride (PubChem CID 70895794) has the molecular formula C6H12ClF3N2O2S
and a molecular weight of 268.69 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride |
| PubChem CID | 70895794 |
| Molecular Formula | C6H12ClF3N2O2S |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NC1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O2S.ClH/c7-6(8,9)14(12,13)11-5-1-3-10-4-2-5;/h5,10-11H,1-4H2;1H |
| InChIKey | DYTZLFMMHVTECB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride?
The IUPAC name of 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride (CID 70895794) is 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride.
What is the SMILES notation for 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride?
The canonical SMILES for 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride is Cl.O=S(=O)(NC1CCNCC1)C(F)(F)F.
What is the InChIKey of 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride?
The InChIKey is DYTZLFMMHVTECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F3N2O2S.ClH/c7-6(8,9)14(12,13)11-5-1-3-10-4-2-5;/h5,10-11H,1-4H2;1H.
What are the key properties of 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride?
1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride has a molecular weight of 268.69 g/mol, XLogP of 0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-trifluoro-N-piperidin-4-ylmethanesulfonamide;hydrochloride is sourced from PubChem (CID 70895794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).