About 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one
3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one (PubChem CID 70895858) has the molecular formula C13H18F3N3O2
and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one.
Molecular Properties
| Compound Name | 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one |
| PubChem CID | 70895858 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one |
| SMILES | CN1CCN(C(c2c(O)c(=O)ccn2C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H18F3N3O2/c1-17-5-7-19(8-6-17)12(13(14,15)16)10-11(21)9(20)3-4-18(10)2/h3-4,12,21H,5-8H2,1-2H3 |
| InChIKey | AIORZTISCDYLKY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one?
The IUPAC name of 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one (CID 70895858) is 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one.
What is the SMILES notation for 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one?
The canonical SMILES for 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one is CN1CCN(C(c2c(O)c(=O)ccn2C)C(F)(F)F)CC1.
What is the InChIKey of 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one?
The InChIKey is AIORZTISCDYLKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3N3O2/c1-17-5-7-19(8-6-17)12(13(14,15)16)10-11(21)9(20)3-4-18(10)2/h3-4,12,21H,5-8H2,1-2H3.
What are the key properties of 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one?
3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one has a molecular weight of 305.30 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1-methyl-2-[2,2,2-trifluoro-1-(4-methylpiperazin-1-yl)ethyl]pyridin-4-one is sourced from PubChem (CID 70895858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).