C17H20N4O — CID 70896232
10-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 70896232) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 10-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 10-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 70896232 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 10-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1c2cccc3ncn(c23)CCN1[C@@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C17H20N4O/c22-17-13-2-1-3-14-16(13)20(11-18-14)8-9-21(17)15-10-19-6-4-12(15)5-7-19/h1-3,11-12,15H,4-10H2/t15-/m1/s1 |
| InChIKey | YLPZXKURYOEIQJ-OAHLLOKOSA-N |
| XLogP | 1.59 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |