About 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide
5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide (PubChem CID 70896534) has the molecular formula C12H17BrN2O
and a molecular weight of 285.19 g/mol. Its IUPAC name is 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide |
| PubChem CID | 70896534 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide |
| SMILES | Cc1cc(Br)cnc1C(=O)N(C)C(C)(C)C |
| InChI | InChI=1S/C12H17BrN2O/c1-8-6-9(13)7-14-10(8)11(16)15(5)12(2,3)4/h6-7H,1-5H3 |
| InChIKey | PJHZXLXYSOMWSE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide?
The IUPAC name of 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide (CID 70896534) is 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide.
What is the SMILES notation for 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide?
The canonical SMILES for 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide is Cc1cc(Br)cnc1C(=O)N(C)C(C)(C)C.
What is the InChIKey of 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide?
The InChIKey is PJHZXLXYSOMWSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2O/c1-8-6-9(13)7-14-10(8)11(16)15(5)12(2,3)4/h6-7H,1-5H3.
What are the key properties of 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide?
5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide has a molecular weight of 285.19 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-tert-butyl-N,3-dimethylpyridine-2-carboxamide is sourced from PubChem (CID 70896534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).