C29H29NO3S — CID 70896739
5-[4-(2-piperidin-1-ylethoxy)phenoxy]-6-(4-sulfanylphenyl)naphthalen-2-ol (PubChem CID 70896739) has the molecular formula C29H29NO3S and a molecular weight of 471.62 g/mol. Its IUPAC name is 5-[4-(2-piperidin-1-ylethoxy)phenoxy]-6-(4-sulfanylphenyl)naphthalen-2-ol.
| Compound Name | 5-[4-(2-piperidin-1-ylethoxy)phenoxy]-6-(4-sulfanylphenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 70896739 |
| Molecular Formula | C29H29NO3S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 5-[4-(2-piperidin-1-ylethoxy)phenoxy]-6-(4-sulfanylphenyl)naphthalen-2-ol |
| SMILES | Oc1ccc2c(Oc3ccc(OCCN4CCCCC4)cc3)c(-c3ccc(S)cc3)ccc2c1 |
| InChI | InChI=1S/C29H29NO3S/c31-23-7-15-28-22(20-23)6-14-27(21-4-12-26(34)13-5-21)29(28)33-25-10-8-24(9-11-25)32-19-18-30-16-2-1-3-17-30/h4-15,20,31,34H,1-3,16-19H2 |
| InChIKey | YHSXPHNFKYOCKR-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|