C31H42N2O5 — CID 70896803
(2R,4R,7S,14Z)-7-tert-butyl-2,17-dimethoxy-4,12,12-trimethyl-10-oxa-5,8-diazatetracyclo[14.5.3.12,5.019,23]pentacosa-1(22),14,16,18,20,23-hexaene-6,9-dione (PubChem CID 70896803) has the molecular formula C31H42N2O5 and a molecular weight of 522.69 g/mol. Its IUPAC name is (2R,4R,7S,14Z)-7-tert-butyl-2,17-dimethoxy-4,12,12-trimethyl-10-oxa-5,8-diazatetracyclo[14.5.3.12,5.019,23]pentacosa-1(22),14,16,18,20,23-hexaene-6,9-dione.
| Compound Name | (2R,4R,7S,14Z)-7-tert-butyl-2,17-dimethoxy-4,12,12-trimethyl-10-oxa-5,8-diazatetracyclo[14.5.3.12,5.019,23]pentacosa-1(22),14,16,18,20,23-hexaene-6,9-dione |
|---|---|
| PubChem CID | 70896803 |
| Molecular Formula | C31H42N2O5 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | (2R,4R,7S,14Z)-7-tert-butyl-2,17-dimethoxy-4,12,12-trimethyl-10-oxa-5,8-diazatetracyclo[14.5.3.12,5.019,23]pentacosa-1(22),14,16,18,20,23-hexaene-6,9-dione |
| SMILES | COc1cc2ccc3cc2cc1/C=C\CC(C)(C)COC(=O)N[C@@H](C(C)(C)C)C(=O)N1C[C@@]3(OC)C[C@H]1C |
| InChI | InChI=1S/C31H42N2O5/c1-20-17-31(37-8)18-33(20)27(34)26(29(2,3)4)32-28(35)38-19-30(5,6)13-9-10-22-14-23-15-24(31)12-11-21(23)16-25(22)36-7/h9-12,14-16,20,26H,13,17-19H2,1-8H3,(H,32,35)/b10-9-/t20-,26-,31+/m1/s1 |
| InChIKey | UJICWVMSFONXTB-VUHGJBPISA-N |
| XLogP | 5.89 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |