C22H38O2Si — CID 70897218
[(4S,7aS)-1-[1-(2-methoxyethenyl)cyclopropyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 70897218) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is [(4S,7aS)-1-[1-(2-methoxyethenyl)cyclopropyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4S,7aS)-1-[1-(2-methoxyethenyl)cyclopropyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 70897218 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | [(4S,7aS)-1-[1-(2-methoxyethenyl)cyclopropyl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COC=CC1(C2=CCC3[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]23C)CC1 |
| InChI | InChI=1S/C22H38O2Si/c1-20(2,3)25(6,7)24-18-9-8-12-21(4)17(18)10-11-19(21)22(13-14-22)15-16-23-5/h11,15-18H,8-10,12-14H2,1-7H3/t17?,18-,21-/m0/s1 |
| InChIKey | YATUYDRRNHSNNG-VLQCZPCNSA-N |
| XLogP | 6.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|