C19H33NO2 — CID 70898710
(1S,3R,7S,8S)-8-[(3R,5S)-5-amino-3-hydroxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol (PubChem CID 70898710) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is (1S,3R,7S,8S)-8-[(3R,5S)-5-amino-3-hydroxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol.
| Compound Name | (1S,3R,7S,8S)-8-[(3R,5S)-5-amino-3-hydroxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 70898710 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | (1S,3R,7S,8S)-8-[(3R,5S)-5-amino-3-hydroxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-ol |
| SMILES | CC[C@H](N)C[C@H](O)CC[C@@H]1C2C(=C[C@H](C)C[C@@H]2O)C=C[C@@H]1C |
| InChI | InChI=1S/C19H33NO2/c1-4-15(20)11-16(21)7-8-17-13(3)5-6-14-9-12(2)10-18(22)19(14)17/h5-6,9,12-13,15-19,21-22H,4,7-8,10-11,20H2,1-3H3/t12-,13-,15-,16+,17-,18-,19?/m0/s1 |
| InChIKey | JUZDHGCJRKZGQL-MUCBOFQOSA-N |
| XLogP | 3.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |