C12H21NO2 — CID 70899637
(4S,5R)-5-cyclohexyl-3-ethyl-4-methyl-1,3-oxazolidin-2-one (PubChem CID 70899637) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (4S,5R)-5-cyclohexyl-3-ethyl-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-5-cyclohexyl-3-ethyl-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70899637 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (4S,5R)-5-cyclohexyl-3-ethyl-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CCN1C(=O)O[C@H](C2CCCCC2)[C@@H]1C |
| InChI | InChI=1S/C12H21NO2/c1-3-13-9(2)11(15-12(13)14)10-7-5-4-6-8-10/h9-11H,3-8H2,1-2H3/t9-,11-/m0/s1 |
| InChIKey | QORRUWUPVPRGMW-ONGXEEELSA-N |
| XLogP | 2.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |