C10H9Cl2NO2 — CID 70899650
(5R)-5-(3,5-dichlorophenyl)-4-methyl-1,3-oxazolidin-2-one (PubChem CID 70899650) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is (5R)-5-(3,5-dichlorophenyl)-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(3,5-dichlorophenyl)-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70899650 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | (5R)-5-(3,5-dichlorophenyl)-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1NC(=O)O[C@@H]1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2NO2/c1-5-9(15-10(14)13-5)6-2-7(11)4-8(12)3-6/h2-5,9H,1H3,(H,13,14)/t5?,9-/m0/s1 |
| InChIKey | RAENUQGTCKEVCY-YQFNKJDISA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |