About (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one
(4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one (PubChem CID 70899696) has the molecular formula C13H15Cl2NO
and a molecular weight of 272.17 g/mol. Its IUPAC name is (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one |
| PubChem CID | 70899696 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one |
| SMILES | CCN1C(=O)C[C@H](c2cc(Cl)cc(Cl)c2)[C@@H]1C |
| InChI | InChI=1S/C13H15Cl2NO/c1-3-16-8(2)12(7-13(16)17)9-4-10(14)6-11(15)5-9/h4-6,8,12H,3,7H2,1-2H3/t8-,12-/m0/s1 |
| InChIKey | DCLNGXXFNSOLGC-UFBFGSQYSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one?
The IUPAC name of (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one (CID 70899696) is (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one.
What is the SMILES notation for (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one?
The canonical SMILES for (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one is CCN1C(=O)C[C@H](c2cc(Cl)cc(Cl)c2)[C@@H]1C.
What is the InChIKey of (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one?
The InChIKey is DCLNGXXFNSOLGC-UFBFGSQYSA-N. The full InChI is InChI=1S/C13H15Cl2NO/c1-3-16-8(2)12(7-13(16)17)9-4-10(14)6-11(15)5-9/h4-6,8,12H,3,7H2,1-2H3/t8-,12-/m0/s1.
What are the key properties of (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one?
(4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one has a molecular weight of 272.17 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-4-(3,5-dichlorophenyl)-1-ethyl-5-methylpyrrolidin-2-one is sourced from PubChem (CID 70899696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).