About 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine
4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine (PubChem CID 70899879) has the molecular formula C17H33NO2
and a molecular weight of 283.46 g/mol. Its IUPAC name is 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine |
| PubChem CID | 70899879 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine |
| SMILES | CCCCOC[C@@H]1C[C@H](CCN2CCOCC2)C1(C)C |
| InChI | InChI=1S/C17H33NO2/c1-4-5-10-20-14-16-13-15(17(16,2)3)6-7-18-8-11-19-12-9-18/h15-16H,4-14H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | DVUDBYSAIUJBFT-HOTGVXAUSA-N |
| XLogP | 3.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine?
The IUPAC name of 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine (CID 70899879) is 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine.
What is the SMILES notation for 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine?
The canonical SMILES for 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine is CCCCOC[C@@H]1C[C@H](CCN2CCOCC2)C1(C)C.
What is the InChIKey of 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine?
The InChIKey is DVUDBYSAIUJBFT-HOTGVXAUSA-N. The full InChI is InChI=1S/C17H33NO2/c1-4-5-10-20-14-16-13-15(17(16,2)3)6-7-18-8-11-19-12-9-18/h15-16H,4-14H2,1-3H3/t15-,16-/m0/s1.
What are the key properties of 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine?
4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine has a molecular weight of 283.46 g/mol, XLogP of 3.19, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]morpholine is sourced from PubChem (CID 70899879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).