About 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine
1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine (PubChem CID 70899900) has the molecular formula C18H35NO
and a molecular weight of 281.48 g/mol. Its IUPAC name is 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine.
Molecular Properties
| Compound Name | 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine |
| PubChem CID | 70899900 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine |
| SMILES | CCCCOC[C@@H]1C[C@H](CCN2CCCCC2)C1(C)C |
| InChI | InChI=1S/C18H35NO/c1-4-5-13-20-15-17-14-16(18(17,2)3)9-12-19-10-7-6-8-11-19/h16-17H,4-15H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | DVRJMRBNFWSDPE-IRXDYDNUSA-N |
| XLogP | 4.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine?
The IUPAC name of 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine (CID 70899900) is 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine.
What is the SMILES notation for 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine?
The canonical SMILES for 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine is CCCCOC[C@@H]1C[C@H](CCN2CCCCC2)C1(C)C.
What is the InChIKey of 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine?
The InChIKey is DVRJMRBNFWSDPE-IRXDYDNUSA-N. The full InChI is InChI=1S/C18H35NO/c1-4-5-13-20-15-17-14-16(18(17,2)3)9-12-19-10-7-6-8-11-19/h16-17H,4-15H2,1-3H3/t16-,17-/m0/s1.
What are the key properties of 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine?
1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine has a molecular weight of 281.48 g/mol, XLogP of 4.34, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(1R,3R)-3-(butoxymethyl)-2,2-dimethylcyclobutyl]ethyl]piperidine is sourced from PubChem (CID 70899900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).