C17H15N7 — CID 70901072
6-N-(3-pyridin-3-ylphenyl)imidazo[1,2-b]pyridazine-3,6,8-triamine (PubChem CID 70901072) has the molecular formula C17H15N7 and a molecular weight of 317.36 g/mol. Its IUPAC name is 6-N-(3-pyridin-3-ylphenyl)imidazo[1,2-b]pyridazine-3,6,8-triamine.
| Compound Name | 6-N-(3-pyridin-3-ylphenyl)imidazo[1,2-b]pyridazine-3,6,8-triamine |
|---|---|
| PubChem CID | 70901072 |
| Molecular Formula | C17H15N7 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 6-N-(3-pyridin-3-ylphenyl)imidazo[1,2-b]pyridazine-3,6,8-triamine |
| SMILES | Nc1cc(Nc2cccc(-c3cccnc3)c2)nn2c(N)cnc12 |
| InChI | InChI=1S/C17H15N7/c18-14-8-16(23-24-15(19)10-21-17(14)24)22-13-5-1-3-11(7-13)12-4-2-6-20-9-12/h1-10H,18-19H2,(H,22,23) |
| InChIKey | HFYZPOZZJRPENP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|