C23H24N6O — CID 70901925
5-(4-butoxyphenyl)-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]-1,2,4-triazin-3-amine (PubChem CID 70901925) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-butoxyphenyl)-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 70901925 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 5-(4-butoxyphenyl)-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]-1,2,4-triazin-3-amine |
| SMILES | CCCCOc1ccc(-c2cnnc(NCc3cc(-c4ccccc4)n[nH]3)n2)cc1 |
| InChI | InChI=1S/C23H24N6O/c1-2-3-13-30-20-11-9-18(10-12-20)22-16-25-29-23(26-22)24-15-19-14-21(28-27-19)17-7-5-4-6-8-17/h4-12,14,16H,2-3,13,15H2,1H3,(H,27,28)(H,24,26,29) |
| InChIKey | ZFGPUQBKEMBZNX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|