About N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide (PubChem CID 70902088) has the molecular formula C17H14BNO4S
and a molecular weight of 339.18 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide |
| PubChem CID | 70902088 |
| Molecular Formula | C17H14BNO4S |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)B(O)OC2)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H14BNO4S/c20-18-17-10-15(7-5-14(17)11-23-18)19-24(21,22)16-8-6-12-3-1-2-4-13(12)9-16/h1-10,19-20H,11H2 |
| InChIKey | BGWLQHAPVCGARL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide?
The IUPAC name of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide (CID 70902088) is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide.
What is the SMILES notation for N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide?
The canonical SMILES for N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide is O=S(=O)(Nc1ccc2c(c1)B(O)OC2)c1ccc2ccccc2c1.
What is the InChIKey of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide?
The InChIKey is BGWLQHAPVCGARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BNO4S/c20-18-17-10-15(7-5-14(17)11-23-18)19-24(21,22)16-8-6-12-3-1-2-4-13(12)9-16/h1-10,19-20H,11H2.
What are the key properties of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide?
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide has a molecular weight of 339.18 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)naphthalene-2-sulfonamide is sourced from PubChem (CID 70902088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).