C34H62O — CID 70902237
(2S)-1-[(3R)-3,6-dimethyl-5-(4-methylcyclohexyl)-6-(4-propylcyclohexyl)heptyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ol (PubChem CID 70902237) has the molecular formula C34H62O and a molecular weight of 486.87 g/mol. Its IUPAC name is (2S)-1-[(3R)-3,6-dimethyl-5-(4-methylcyclohexyl)-6-(4-propylcyclohexyl)heptyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ol.
| Compound Name | (2S)-1-[(3R)-3,6-dimethyl-5-(4-methylcyclohexyl)-6-(4-propylcyclohexyl)heptyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 70902237 |
| Molecular Formula | C34H62O |
| Molecular Weight | 486.87 g/mol |
| Exact Mass | 486.48 |
| IUPAC Name | (2S)-1-[(3R)-3,6-dimethyl-5-(4-methylcyclohexyl)-6-(4-propylcyclohexyl)heptyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-ol |
| SMILES | CCCC1CCC(C(C)(C)C(C[C@H](C)CCC2C3CCCCC3C[C@@H]2O)C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C34H62O/c1-6-9-26-15-19-29(20-16-26)34(4,5)32(27-17-12-24(2)13-18-27)22-25(3)14-21-31-30-11-8-7-10-28(30)23-33(31)35/h24-33,35H,6-23H2,1-5H3/t24?,25-,26?,27?,28?,29?,30?,31?,32?,33+/m1/s1 |
| InChIKey | QXCDAJCNHYMXNQ-AZLUUUQFSA-N |
| XLogP | 10.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.87 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |