C43H54N4O5 — CID 70902265
6-(1,3-benzodioxol-5-yl)-4-[5-[[8-[5-(diethylamino)pentoxy]isoquinolin-6-yl]oxymethyl-ethylamino]pentylamino]naphthalen-2-ol (PubChem CID 70902265) has the molecular formula C43H54N4O5 and a molecular weight of 706.93 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-4-[5-[[8-[5-(diethylamino)pentoxy]isoquinolin-6-yl]oxymethyl-ethylamino]pentylamino]naphthalen-2-ol.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-4-[5-[[8-[5-(diethylamino)pentoxy]isoquinolin-6-yl]oxymethyl-ethylamino]pentylamino]naphthalen-2-ol |
|---|---|
| PubChem CID | 70902265 |
| Molecular Formula | C43H54N4O5 |
| Molecular Weight | 706.93 g/mol |
| Exact Mass | 706.41 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-4-[5-[[8-[5-(diethylamino)pentoxy]isoquinolin-6-yl]oxymethyl-ethylamino]pentylamino]naphthalen-2-ol |
| SMILES | CCN(CC)CCCCCOc1cc(OCN(CC)CCCCCNc2cc(O)cc3ccc(-c4ccc5c(c4)OCO5)cc23)cc2ccncc12 |
| InChI | InChI=1S/C43H54N4O5/c1-4-46(5-2)20-11-8-12-22-49-42-28-37(24-35-17-19-44-29-39(35)42)50-30-47(6-3)21-10-7-9-18-45-40-27-36(48)23-34-14-13-32(25-38(34)40)33-15-16-41-43(26-33)52-31-51-41/h13-17,19,23-29,45,48H,4-12,18,20-22,30-31H2,1-3H3 |
| InChIKey | DSXIPOQUQZRPRC-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.93 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|