C29H33N7O2S2 — CID 70902318
1-[5-[2-[[2-[4-[3-(dimethylamino)propoxy]phenyl]-[1,3]thiazolo[5,4-b]pyridin-7-yl]amino]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea (PubChem CID 70902318) has the molecular formula C29H33N7O2S2 and a molecular weight of 575.76 g/mol. Its IUPAC name is 1-[5-[2-[[2-[4-[3-(dimethylamino)propoxy]phenyl]-[1,3]thiazolo[5,4-b]pyridin-7-yl]amino]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea.
| Compound Name | 1-[5-[2-[[2-[4-[3-(dimethylamino)propoxy]phenyl]-[1,3]thiazolo[5,4-b]pyridin-7-yl]amino]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 70902318 |
| Molecular Formula | C29H33N7O2S2 |
| Molecular Weight | 575.76 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 1-[5-[2-[[2-[4-[3-(dimethylamino)propoxy]phenyl]-[1,3]thiazolo[5,4-b]pyridin-7-yl]amino]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea |
| SMILES | CN(C)CCCOc1ccc(-c2nc3c(NCCC4CN=C(NC(=O)Nc5ccccc5)S4)ccnc3s2)cc1 |
| InChI | InChI=1S/C29H33N7O2S2/c1-36(2)17-6-18-38-22-11-9-20(10-12-22)26-34-25-24(14-16-31-27(25)40-26)30-15-13-23-19-32-29(39-23)35-28(37)33-21-7-4-3-5-8-21/h3-5,7-12,14,16,23H,6,13,15,17-19H2,1-2H3,(H,30,31)(H2,32,33,35,37) |
| InChIKey | QDOPOXXKZYJDQN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.76 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|