C23H19ClN2O3 — CID 70903149
methyl 5-[[6-chloro-5-(3-methylphenyl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoate (PubChem CID 70903149) has the molecular formula C23H19ClN2O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is methyl 5-[[6-chloro-5-(3-methylphenyl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoate.
| Compound Name | methyl 5-[[6-chloro-5-(3-methylphenyl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoate |
|---|---|
| PubChem CID | 70903149 |
| Molecular Formula | C23H19ClN2O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | methyl 5-[[6-chloro-5-(3-methylphenyl)-1H-benzimidazol-2-yl]oxy]-2-methylbenzoate |
| SMILES | COC(=O)c1cc(Oc2nc3cc(-c4cccc(C)c4)c(Cl)cc3[nH]2)ccc1C |
| InChI | InChI=1S/C23H19ClN2O3/c1-13-5-4-6-15(9-13)18-11-20-21(12-19(18)24)26-23(25-20)29-16-8-7-14(2)17(10-16)22(27)28-3/h4-12H,1-3H3,(H,25,26) |
| InChIKey | WHQQBEUCOIZBFP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |