C14H26O4Si — CID 70903432
[(2S,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]methyl-trimethylsilane (PubChem CID 70903432) has the molecular formula C14H26O4Si and a molecular weight of 286.44 g/mol. Its IUPAC name is [(2S,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]methyl-trimethylsilane.
| Compound Name | [(2S,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 70903432 |
| Molecular Formula | C14H26O4Si |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(2S,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]methyl-trimethylsilane |
| SMILES | CO[C@H]1C=C[C@@H](CC2OCCO2)O[C@@H]1C[Si](C)(C)C |
| InChI | InChI=1S/C14H26O4Si/c1-15-12-6-5-11(9-14-16-7-8-17-14)18-13(12)10-19(2,3)4/h5-6,11-14H,7-10H2,1-4H3/t11-,12-,13+/m0/s1 |
| InChIKey | HDEFLPXJWQPAFE-RWMBFGLXSA-N |
| XLogP | 2.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|