C31H42O6Si — CID 70903446
1-[(2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]-7-[hydroxy(diphenyl)silyl]-7-methyloctan-4-one (PubChem CID 70903446) has the molecular formula C31H42O6Si and a molecular weight of 538.76 g/mol. Its IUPAC name is 1-[(2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]-7-[hydroxy(diphenyl)silyl]-7-methyloctan-4-one.
| Compound Name | 1-[(2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]-7-[hydroxy(diphenyl)silyl]-7-methyloctan-4-one |
|---|---|
| PubChem CID | 70903446 |
| Molecular Formula | C31H42O6Si |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 1-[(2R,3S,6R)-6-(1,3-dioxolan-2-ylmethyl)-3-methoxy-3,6-dihydro-2H-pyran-2-yl]-7-[hydroxy(diphenyl)silyl]-7-methyloctan-4-one |
| SMILES | CO[C@H]1C=C[C@@H](CC2OCCO2)O[C@@H]1CCCC(=O)CCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H42O6Si/c1-31(2,38(33,26-12-6-4-7-13-26)27-14-8-5-9-15-27)20-19-24(32)11-10-16-29-28(34-3)18-17-25(37-29)23-30-35-21-22-36-30/h4-9,12-15,17-18,25,28-30,33H,10-11,16,19-23H2,1-3H3/t25-,28-,29+/m0/s1 |
| InChIKey | HPCHSHYAUCZREQ-OWPQXHQJSA-N |
| XLogP | 4.14 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|