C20H28N4 — CID 70903875
6-(6-methyl-1,2,3,6-tetrahydropyridin-2-yl)-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine (PubChem CID 70903875) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 6-(6-methyl-1,2,3,6-tetrahydropyridin-2-yl)-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine.
| Compound Name | 6-(6-methyl-1,2,3,6-tetrahydropyridin-2-yl)-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine |
|---|---|
| PubChem CID | 70903875 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 6-(6-methyl-1,2,3,6-tetrahydropyridin-2-yl)-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine |
| SMILES | CC1C=CCC(c2cc(NC3CCNCC3)c3c(c2)=CCNC=3)N1 |
| InChI | InChI=1S/C20H28N4/c1-14-3-2-4-19(23-14)16-11-15-5-8-22-13-18(15)20(12-16)24-17-6-9-21-10-7-17/h2-3,5,11-14,17,19,21-24H,4,6-10H2,1H3 |
| InChIKey | AFDBJQBDBZFGHC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|