C20H25FN4 — CID 70903928
6-(2-fluoro-5-methyl-1,2-dihydropyridin-3-yl)-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine (PubChem CID 70903928) has the molecular formula C20H25FN4 and a molecular weight of 340.45 g/mol. Its IUPAC name is 6-(2-fluoro-5-methyl-1,2-dihydropyridin-3-yl)-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine.
| Compound Name | 6-(2-fluoro-5-methyl-1,2-dihydropyridin-3-yl)-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine |
|---|---|
| PubChem CID | 70903928 |
| Molecular Formula | C20H25FN4 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 6-(2-fluoro-5-methyl-1,2-dihydropyridin-3-yl)-N-piperidin-4-yl-2,3-dihydroisoquinolin-8-amine |
| SMILES | CC1=CNC(F)C(c2cc(NC3CCNCC3)c3c(c2)=CCNC=3)=C1 |
| InChI | InChI=1S/C20H25FN4/c1-13-8-17(20(21)24-11-13)15-9-14-2-5-23-12-18(14)19(10-15)25-16-3-6-22-7-4-16/h2,8-12,16,20,22-25H,3-7H2,1H3 |
| InChIKey | PYNZSDICSCKPHW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|