C9H6BrN3S — CID 70904414
11-bromo-3-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene (PubChem CID 70904414) has the molecular formula C9H6BrN3S and a molecular weight of 268.14 g/mol. Its IUPAC name is 11-bromo-3-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene.
| Compound Name | 11-bromo-3-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 70904414 |
| Molecular Formula | C9H6BrN3S |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | 11-bromo-3-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
| SMILES | Cn1cnc2cnc3cc(Br)sc3c21 |
| InChI | InChI=1S/C9H6BrN3S/c1-13-4-12-6-3-11-5-2-7(10)14-9(5)8(6)13/h2-4H,1H3 |
| InChIKey | OIHNOEQURXIZTQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |