C11H20Cl3N2O2+ — CID 7090465
N-[(1R)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]propanamide (PubChem CID 7090465) has the molecular formula C11H20Cl3N2O2+ and a molecular weight of 318.65 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]propanamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 7090465 |
| Molecular Formula | C11H20Cl3N2O2+ |
| Molecular Weight | 318.65 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethyl]propanamide |
| SMILES | CCC(=O)N[C@H]([NH+]1C[C@@H](C)O[C@H](C)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H19Cl3N2O2/c1-4-9(17)15-10(11(12,13)14)16-5-7(2)18-8(3)6-16/h7-8,10H,4-6H2,1-3H3,(H,15,17)/p+1/t7-,8-,10-/m1/s1 |
| InChIKey | VJEWQZCTQBQROB-NQMVMOMDSA-O |
| XLogP | 0.90 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.65 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|