C15H19NO — CID 70904789
(2E,4Z,6E)-8-ethyl-2-methyl-11,12-dihydro-1,8-benzoxazecine (PubChem CID 70904789) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (2E,4Z,6E)-8-ethyl-2-methyl-11,12-dihydro-1,8-benzoxazecine.
| Compound Name | (2E,4Z,6E)-8-ethyl-2-methyl-11,12-dihydro-1,8-benzoxazecine |
|---|---|
| PubChem CID | 70904789 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (2E,4Z,6E)-8-ethyl-2-methyl-11,12-dihydro-1,8-benzoxazecine |
| SMILES | CCN1/C=C/C=C\C=C(/C)OC2=C1C=CCC2 |
| InChI | InChI=1S/C15H19NO/c1-3-16-12-8-4-5-9-13(2)17-15-11-7-6-10-14(15)16/h4-6,8-10,12H,3,7,11H2,1-2H3/b5-4-,12-8+,13-9+ |
| InChIKey | QOELIUPTLRWLSX-NHXPPBEUSA-N |
| XLogP | 3.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |