C24H36O3S — CID 70904891
(1R,6Z,13R,15S,16R,17S)-16,17-dimethoxy-15-phenylsulfanyl-14-oxabicyclo[11.4.0]heptadec-6-ene (PubChem CID 70904891) has the molecular formula C24H36O3S and a molecular weight of 404.62 g/mol. Its IUPAC name is (1R,6Z,13R,15S,16R,17S)-16,17-dimethoxy-15-phenylsulfanyl-14-oxabicyclo[11.4.0]heptadec-6-ene.
| Compound Name | (1R,6Z,13R,15S,16R,17S)-16,17-dimethoxy-15-phenylsulfanyl-14-oxabicyclo[11.4.0]heptadec-6-ene |
|---|---|
| PubChem CID | 70904891 |
| Molecular Formula | C24H36O3S |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (1R,6Z,13R,15S,16R,17S)-16,17-dimethoxy-15-phenylsulfanyl-14-oxabicyclo[11.4.0]heptadec-6-ene |
| SMILES | CO[C@@H]1[C@@H](OC)[C@@H]2CCCC/C=C\CCCCC[C@H]2O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C24H36O3S/c1-25-22-20-17-13-8-6-4-3-5-7-9-14-18-21(20)27-24(23(22)26-2)28-19-15-11-10-12-16-19/h3-4,10-12,15-16,20-24H,5-9,13-14,17-18H2,1-2H3/b4-3-/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | CUXBQBQQOHJBDP-IGIGGLBJSA-N |
| XLogP | 6.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|