C19H28FN3O — CID 70905112
9-(4-fluorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)nonan-3-ol (PubChem CID 70905112) has the molecular formula C19H28FN3O and a molecular weight of 333.45 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)nonan-3-ol.
| Compound Name | 9-(4-fluorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)nonan-3-ol |
|---|---|
| PubChem CID | 70905112 |
| Molecular Formula | C19H28FN3O |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 9-(4-fluorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)nonan-3-ol |
| SMILES | CC(C)(C)C(O)C(CCCCCc1ccc(F)cc1)n1cncn1 |
| InChI | InChI=1S/C19H28FN3O/c1-19(2,3)18(24)17(23-14-21-13-22-23)8-6-4-5-7-15-9-11-16(20)12-10-15/h9-14,17-18,24H,4-8H2,1-3H3 |
| InChIKey | CPMOVUXCJIFTHQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|