About dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium
dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium (PubChem CID 70905170) has the molecular formula C18H34N+
and a molecular weight of 264.48 g/mol. Its IUPAC name is dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium.
Molecular Properties
| Compound Name | dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium |
| PubChem CID | 70905170 |
| Molecular Formula | C18H34N+ |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.27 |
| IUPAC Name | dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium |
| SMILES | CCCC[N+](CCC)(CCCC)CC1=CCCC=C1 |
| InChI | InChI=1S/C18H34N/c1-4-7-15-19(14-6-3,16-8-5-2)17-18-12-10-9-11-13-18/h10,12-13H,4-9,11,14-17H2,1-3H3/q+1 |
| InChIKey | JZLQDJKLNFVOLE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium?
The IUPAC name of dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium (CID 70905170) is dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium.
What is the SMILES notation for dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium?
The canonical SMILES for dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium is CCCC[N+](CCC)(CCCC)CC1=CCCC=C1.
What is the InChIKey of dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium?
The InChIKey is JZLQDJKLNFVOLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34N/c1-4-7-15-19(14-6-3,16-8-5-2)17-18-12-10-9-11-13-18/h10,12-13H,4-9,11,14-17H2,1-3H3/q+1.
What are the key properties of dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium?
dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium has a molecular weight of 264.48 g/mol, XLogP of 5.09, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl-(cyclohexa-1,5-dien-1-ylmethyl)-propylazanium is sourced from PubChem (CID 70905170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).