C11H17BFN3O2 — CID 70905850
4-(fluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (PubChem CID 70905850) has the molecular formula C11H17BFN3O2 and a molecular weight of 253.09 g/mol. Its IUPAC name is 4-(fluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine.
| Compound Name | 4-(fluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 70905850 |
| Molecular Formula | C11H17BFN3O2 |
| Molecular Weight | 253.09 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 4-(fluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| SMILES | CC1(C)OB(c2cnc(N)nc2CF)OC1(C)C |
| InChI | InChI=1S/C11H17BFN3O2/c1-10(2)11(3,4)18-12(17-10)7-6-15-9(14)16-8(7)5-13/h6H,5H2,1-4H3,(H2,14,15,16) |
| InChIKey | ZJYUCTPWDMSVQI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.09 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|