C12H23O14P — CID 70905911
[(3S,6R)-3,4,5-trihydroxy-6-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl dihydrogen phosphate (PubChem CID 70905911) has the molecular formula C12H23O14P and a molecular weight of 422.28 g/mol. Its IUPAC name is [(3S,6R)-3,4,5-trihydroxy-6-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(3S,6R)-3,4,5-trihydroxy-6-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 70905911 |
| Molecular Formula | C12H23O14P |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [(3S,6R)-3,4,5-trihydroxy-6-[(2R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCC1O[C@H](O[C@H]2OC(CO)[C@@H](O)[C@H](O)C2O)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C12H23O14P/c13-1-3-5(14)7(16)9(18)11(24-3)26-12-10(19)8(17)6(15)4(25-12)2-23-27(20,21)22/h3-19H,1-2H2,(H2,20,21,22)/t3?,4?,5-,6-,7+,8?,9?,10?,11-,12-/m1/s1 |
| InChIKey | LABSPYBHMPDTEL-CBOJNUKRSA-N |
| XLogP | -5.28 |
| TPSA | 236.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | -5.28 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|