C29H50O12Si — CID 70905934
[(2R,4S,5R)-3-acetyloxy-2-[(2R,5S,6R)-4,5-diacetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxan-2-yl]oxy-6-ethyl-5-methyloxan-4-yl] acetate (PubChem CID 70905934) has the molecular formula C29H50O12Si and a molecular weight of 618.79 g/mol. Its IUPAC name is [(2R,4S,5R)-3-acetyloxy-2-[(2R,5S,6R)-4,5-diacetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxan-2-yl]oxy-6-ethyl-5-methyloxan-4-yl] acetate.
| Compound Name | [(2R,4S,5R)-3-acetyloxy-2-[(2R,5S,6R)-4,5-diacetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxan-2-yl]oxy-6-ethyl-5-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 70905934 |
| Molecular Formula | C29H50O12Si |
| Molecular Weight | 618.79 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | [(2R,4S,5R)-3-acetyloxy-2-[(2R,5S,6R)-4,5-diacetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxan-2-yl]oxy-6-ethyl-5-methyloxan-4-yl] acetate |
| SMILES | CCC1O[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC(C)=O)C(OC(C)=O)C2C)C(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C29H50O12Si/c1-13-21-15(2)23(35-17(4)30)26(38-20(7)33)28(39-21)41-27-16(3)24(36-18(5)31)25(37-19(6)32)22(40-27)14-34-42(11,12)29(8,9)10/h15-16,21-28H,13-14H2,1-12H3/t15-,16?,21?,22-,23+,24?,25-,26?,27-,28-/m1/s1 |
| InChIKey | FHLZPCURJRJLKE-RZEIJOFXSA-N |
| XLogP | 3.88 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|