C24H35FO13 — CID 70905938
[(2R,3S,6R)-3,4-diacetyloxy-6-[(2R,4S,5S)-3,4-diacetyloxy-6-(fluoromethyl)-5-methyloxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate (PubChem CID 70905938) has the molecular formula C24H35FO13 and a molecular weight of 550.53 g/mol. Its IUPAC name is [(2R,3S,6R)-3,4-diacetyloxy-6-[(2R,4S,5S)-3,4-diacetyloxy-6-(fluoromethyl)-5-methyloxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3,4-diacetyloxy-6-[(2R,4S,5S)-3,4-diacetyloxy-6-(fluoromethyl)-5-methyloxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70905938 |
| Molecular Formula | C24H35FO13 |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | [(2R,3S,6R)-3,4-diacetyloxy-6-[(2R,4S,5S)-3,4-diacetyloxy-6-(fluoromethyl)-5-methyloxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O[C@H]2OC(CF)[C@@H](C)[C@H](OC(C)=O)C2OC(C)=O)C(C)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H35FO13/c1-10-17(8-25)36-24(22(35-16(7)30)19(10)32-13(4)27)38-23-11(2)20(33-14(5)28)21(34-15(6)29)18(37-23)9-31-12(3)26/h10-11,17-24H,8-9H2,1-7H3/t10-,11?,17?,18-,19+,20?,21-,22?,23-,24-/m1/s1 |
| InChIKey | GIKOOXLSULXEEX-NXYAGNMBSA-N |
| XLogP | 0.98 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|