C25H35FO15 — CID 70905944
[(2R,3S,6R)-3,4-diacetyloxy-6-[(2R,4R,5S)-3,4-diacetyloxy-6-(acetyloxymethyl)-5-fluorooxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate (PubChem CID 70905944) has the molecular formula C25H35FO15 and a molecular weight of 594.54 g/mol. Its IUPAC name is [(2R,3S,6R)-3,4-diacetyloxy-6-[(2R,4R,5S)-3,4-diacetyloxy-6-(acetyloxymethyl)-5-fluorooxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3,4-diacetyloxy-6-[(2R,4R,5S)-3,4-diacetyloxy-6-(acetyloxymethyl)-5-fluorooxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70905944 |
| Molecular Formula | C25H35FO15 |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | [(2R,3S,6R)-3,4-diacetyloxy-6-[(2R,4R,5S)-3,4-diacetyloxy-6-(acetyloxymethyl)-5-fluorooxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](O[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C2C)C(OC(C)=O)[C@@H](OC(C)=O)[C@H]1F |
| InChI | InChI=1S/C25H35FO15/c1-10-20(35-13(4)29)21(36-14(5)30)18(9-34-12(3)28)40-24(10)41-25-23(38-16(7)32)22(37-15(6)31)19(26)17(39-25)8-33-11(2)27/h10,17-25H,8-9H2,1-7H3/t10?,17?,18-,19+,20?,21-,22+,23?,24-,25-/m1/s1 |
| InChIKey | WTYVWQGMUBBHGQ-DZOQKVCQSA-N |
| XLogP | 0.28 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|