About 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol
4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol (PubChem CID 70905946) has the molecular formula C10H11F5O
and a molecular weight of 242.19 g/mol. Its IUPAC name is 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol.
Molecular Properties
| Compound Name | 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol |
| PubChem CID | 70905946 |
| Molecular Formula | C10H11F5O |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol |
| SMILES | OC1(C(F)(F)F)C(C2C=CCC2)CC1(F)F |
| InChI | InChI=1S/C10H11F5O/c11-8(12)5-7(6-3-1-2-4-6)9(8,16)10(13,14)15/h1,3,6-7,16H,2,4-5H2 |
| InChIKey | CHDGBTXRVSSWNB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol?
The IUPAC name of 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol (CID 70905946) is 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol.
What is the SMILES notation for 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol?
The canonical SMILES for 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol is OC1(C(F)(F)F)C(C2C=CCC2)CC1(F)F.
What is the InChIKey of 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol?
The InChIKey is CHDGBTXRVSSWNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F5O/c11-8(12)5-7(6-3-1-2-4-6)9(8,16)10(13,14)15/h1,3,6-7,16H,2,4-5H2.
What are the key properties of 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol?
4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol has a molecular weight of 242.19 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopent-2-en-1-yl-2,2-difluoro-1-(trifluoromethyl)cyclobutan-1-ol is sourced from PubChem (CID 70905946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).