About tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium
tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium (PubChem CID 70906843) has the molecular formula C19H36N+
and a molecular weight of 278.50 g/mol. Its IUPAC name is tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium.
Molecular Properties
| Compound Name | tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium |
| PubChem CID | 70906843 |
| Molecular Formula | C19H36N+ |
| Molecular Weight | 278.50 g/mol |
| Exact Mass | 278.28 |
| IUPAC Name | tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CC1C=CC=CC1 |
| InChI | InChI=1S/C19H36N/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19/h10-13,19H,4-9,14-18H2,1-3H3/q+1 |
| InChIKey | AOEPRGDUCUAQBR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium?
The IUPAC name of tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium (CID 70906843) is tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium.
What is the SMILES notation for tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium?
The canonical SMILES for tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium is CCCC[N+](CCCC)(CCCC)CC1C=CC=CC1.
What is the InChIKey of tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium?
The InChIKey is AOEPRGDUCUAQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36N/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19/h10-13,19H,4-9,14-18H2,1-3H3/q+1.
What are the key properties of tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium?
tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium has a molecular weight of 278.50 g/mol, XLogP of 5.34, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(cyclohexa-2,4-dien-1-ylmethyl)azanium is sourced from PubChem (CID 70906843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).