C21H20ClF2NO3 — CID 70907433
[(6aS,8R)-10a-[(4-chlorophenyl)methyl]-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl] carbamate (PubChem CID 70907433) has the molecular formula C21H20ClF2NO3 and a molecular weight of 407.84 g/mol. Its IUPAC name is [(6aS,8R)-10a-[(4-chlorophenyl)methyl]-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl] carbamate.
| Compound Name | [(6aS,8R)-10a-[(4-chlorophenyl)methyl]-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl] carbamate |
|---|---|
| PubChem CID | 70907433 |
| Molecular Formula | C21H20ClF2NO3 |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [(6aS,8R)-10a-[(4-chlorophenyl)methyl]-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl] carbamate |
| SMILES | NC(=O)O[C@@H]1CCC2(Cc3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@H]2C1 |
| InChI | InChI=1S/C21H20ClF2NO3/c22-14-3-1-12(2-4-14)10-21-8-7-15(28-20(25)26)9-13(21)11-27-19-17(24)6-5-16(23)18(19)21/h1-6,13,15H,7-11H2,(H2,25,26)/t13-,15-,21?/m1/s1 |
| InChIKey | FIILWDXJRBWWJN-ZRNDULBVSA-N |
| XLogP | 4.76 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |