About 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate
2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 70907498) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate |
| PubChem CID | 70907498 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | CC1(C(=O)OCCO)CC2CC1C1CC21 |
| InChI | InChI=1S/C12H18O3/c1-12(11(14)15-3-2-13)6-7-4-10(12)9-5-8(7)9/h7-10,13H,2-6H2,1H3 |
| InChIKey | KLMQYKOUUGQWRB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate?
The IUPAC name of 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate (CID 70907498) is 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate.
What is the SMILES notation for 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate?
The canonical SMILES for 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate is CC1(C(=O)OCCO)CC2CC1C1CC21.
What is the InChIKey of 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate?
The InChIKey is KLMQYKOUUGQWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-12(11(14)15-3-2-13)6-7-4-10(12)9-5-8(7)9/h7-10,13H,2-6H2,1H3.
What are the key properties of 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate?
2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate has a molecular weight of 210.27 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 6-methyltricyclo[3.2.1.02,4]octane-6-carboxylate is sourced from PubChem (CID 70907498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).