About N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide
N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide (PubChem CID 70907869) has the molecular formula C27H27NO3
and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide.
Molecular Properties
| Compound Name | N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide |
| PubChem CID | 70907869 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide |
| SMILES | COc1c(CN(C(=O)c2ccccc2C)c2ccccc2)ccc2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C27H27NO3/c1-19-10-8-9-13-23(19)26(29)28(22-11-6-5-7-12-22)18-21-15-14-20-16-17-27(2,3)31-25(20)24(21)30-4/h5-17H,18H2,1-4H3 |
| InChIKey | HUIBHQLXPJISMR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide?
The IUPAC name of N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide (CID 70907869) is N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide.
What is the SMILES notation for N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide?
The canonical SMILES for N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide is COc1c(CN(C(=O)c2ccccc2C)c2ccccc2)ccc2c1OC(C)(C)C=C2.
What is the InChIKey of N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide?
The InChIKey is HUIBHQLXPJISMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27NO3/c1-19-10-8-9-13-23(19)26(29)28(22-11-6-5-7-12-22)18-21-15-14-20-16-17-27(2,3)31-25(20)24(21)30-4/h5-17H,18H2,1-4H3.
What are the key properties of N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide?
N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide has a molecular weight of 413.52 g/mol, XLogP of 6.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-2-methyl-N-phenylbenzamide is sourced from PubChem (CID 70907869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).