About 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane
4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane (PubChem CID 70907896) has the molecular formula C16H26O6
and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane.
Molecular Properties
| Compound Name | 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane |
| PubChem CID | 70907896 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane |
| SMILES | C1CC(C2OCC(C3COC(C4CCOCC4)O3)O2)CCO1 |
| InChI | InChI=1S/C16H26O6/c1-5-17-6-2-11(1)15-19-9-13(21-15)14-10-20-16(22-14)12-3-7-18-8-4-12/h11-16H,1-10H2 |
| InChIKey | RDBDLIUGJWGBHQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane?
The IUPAC name of 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane (CID 70907896) is 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane.
What is the SMILES notation for 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane?
The canonical SMILES for 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane is C1CC(C2OCC(C3COC(C4CCOCC4)O3)O2)CCO1.
What is the InChIKey of 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane?
The InChIKey is RDBDLIUGJWGBHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O6/c1-5-17-6-2-11(1)15-19-9-13(21-15)14-10-20-16(22-14)12-3-7-18-8-4-12/h11-16H,1-10H2.
What are the key properties of 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane?
4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane has a molecular weight of 314.38 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]oxane is sourced from PubChem (CID 70907896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).