About (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid
(E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid (PubChem CID 7090794) has the molecular formula C11H14F3NO3
and a molecular weight of 265.23 g/mol. Its IUPAC name is (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid |
| PubChem CID | 7090794 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)N[C@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C11H14F3NO3/c12-11(13,14)7-2-1-3-8(6-7)15-9(16)4-5-10(17)18/h4-5,7-8H,1-3,6H2,(H,15,16)(H,17,18)/b5-4+/t7-,8-/m0/s1 |
| InChIKey | GKEVMNYXOTYLMG-VEVSIANRSA-N |
| XLogP | 1.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid?
The IUPAC name of (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid (CID 7090794) is (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid.
What is the SMILES notation for (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid?
The canonical SMILES for (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid is O=C(O)/C=C/C(=O)N[C@H]1CCC[C@H](C(F)(F)F)C1.
What is the InChIKey of (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid?
The InChIKey is GKEVMNYXOTYLMG-VEVSIANRSA-N. The full InChI is InChI=1S/C11H14F3NO3/c12-11(13,14)7-2-1-3-8(6-7)15-9(16)4-5-10(17)18/h4-5,7-8H,1-3,6H2,(H,15,16)(H,17,18)/b5-4+/t7-,8-/m0/s1.
What are the key properties of (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid?
(E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid has a molecular weight of 265.23 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-oxo-4-[[(1S,3S)-3-(trifluoromethyl)cyclohexyl]amino]but-2-enoic acid is sourced from PubChem (CID 7090794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).