C41H66O8S — CID 70908194
(3R,4S,5S,6R)-3,4,5-tributoxy-2-[2-butoxy-5-[hydroxy-(4-methoxyphenyl)methyl]-4-methylphenyl]-6-(butoxymethyl)thian-2-ol (PubChem CID 70908194) has the molecular formula C41H66O8S and a molecular weight of 719.04 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3,4,5-tributoxy-2-[2-butoxy-5-[hydroxy-(4-methoxyphenyl)methyl]-4-methylphenyl]-6-(butoxymethyl)thian-2-ol.
| Compound Name | (3R,4S,5S,6R)-3,4,5-tributoxy-2-[2-butoxy-5-[hydroxy-(4-methoxyphenyl)methyl]-4-methylphenyl]-6-(butoxymethyl)thian-2-ol |
|---|---|
| PubChem CID | 70908194 |
| Molecular Formula | C41H66O8S |
| Molecular Weight | 719.04 g/mol |
| Exact Mass | 718.45 |
| IUPAC Name | (3R,4S,5S,6R)-3,4,5-tributoxy-2-[2-butoxy-5-[hydroxy-(4-methoxyphenyl)methyl]-4-methylphenyl]-6-(butoxymethyl)thian-2-ol |
| SMILES | CCCCOC[C@H]1SC(O)(c2cc(C(O)c3ccc(OC)cc3)c(C)cc2OCCCC)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C41H66O8S/c1-8-13-22-45-29-36-38(47-24-15-10-3)39(48-25-16-11-4)40(49-26-17-12-5)41(43,50-36)34-28-33(30(6)27-35(34)46-23-14-9-2)37(42)31-18-20-32(44-7)21-19-31/h18-21,27-28,36-40,42-43H,8-17,22-26,29H2,1-7H3/t36-,37?,38-,39+,40-,41?/m1/s1 |
| InChIKey | AJGNQNJWCCAYOY-KOIXCMJRSA-N |
| XLogP | 8.90 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.04 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|