C20H20FN6O6P — CID 70908353
[(3R,3aS)-7-fluoro-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate (PubChem CID 70908353) has the molecular formula C20H20FN6O6P and a molecular weight of 490.39 g/mol. Its IUPAC name is [(3R,3aS)-7-fluoro-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate.
| Compound Name | [(3R,3aS)-7-fluoro-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 70908353 |
| Molecular Formula | C20H20FN6O6P |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [(3R,3aS)-7-fluoro-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate |
| SMILES | O=C1O[C@@H](COP(=O)(O)O)[C@@H]2Cc3cc(-c4ccc(CNCc5cn[nH]n5)nc4)c(F)cc3N12 |
| InChI | InChI=1S/C20H20FN6O6P/c21-16-5-17-12(4-18-19(10-32-34(29,30)31)33-20(28)27(17)18)3-15(16)11-1-2-13(23-6-11)7-22-8-14-9-24-26-25-14/h1-3,5-6,9,18-19,22H,4,7-8,10H2,(H,24,25,26)(H2,29,30,31)/t18-,19-/m0/s1 |
| InChIKey | SZASVKVZRAOENA-OALUTQOASA-N |
| XLogP | 1.65 |
| TPSA | 162.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|