C26H34ClN3O3 — CID 70908519
N-[(2S)-1-[4-(4-tert-butyl-4,5-dihydroimidazol-1-yl)phenyl]-3-hydroxypropan-2-yl]-3-chloro-4-propoxybenzamide (PubChem CID 70908519) has the molecular formula C26H34ClN3O3 and a molecular weight of 472.03 g/mol. Its IUPAC name is N-[(2S)-1-[4-(4-tert-butyl-4,5-dihydroimidazol-1-yl)phenyl]-3-hydroxypropan-2-yl]-3-chloro-4-propoxybenzamide.
| Compound Name | N-[(2S)-1-[4-(4-tert-butyl-4,5-dihydroimidazol-1-yl)phenyl]-3-hydroxypropan-2-yl]-3-chloro-4-propoxybenzamide |
|---|---|
| PubChem CID | 70908519 |
| Molecular Formula | C26H34ClN3O3 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | N-[(2S)-1-[4-(4-tert-butyl-4,5-dihydroimidazol-1-yl)phenyl]-3-hydroxypropan-2-yl]-3-chloro-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N[C@H](CO)Cc2ccc(N3C=NC(C(C)(C)C)C3)cc2)cc1Cl |
| InChI | InChI=1S/C26H34ClN3O3/c1-5-12-33-23-11-8-19(14-22(23)27)25(32)29-20(16-31)13-18-6-9-21(10-7-18)30-15-24(28-17-30)26(2,3)4/h6-11,14,17,20,24,31H,5,12-13,15-16H2,1-4H3,(H,29,32)/t20-,24?/m0/s1 |
| InChIKey | IHYMEEFLLSQMQD-QHELBMECSA-N |
| XLogP | 4.73 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|