C19H24F3N2O2P — CID 70908618
(5R,8S)-8-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-8-phosphanyl-1,9-diazaspiro[4.5]dec-6-en-2-one (PubChem CID 70908618) has the molecular formula C19H24F3N2O2P and a molecular weight of 400.38 g/mol. Its IUPAC name is (5R,8S)-8-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-8-phosphanyl-1,9-diazaspiro[4.5]dec-6-en-2-one.
| Compound Name | (5R,8S)-8-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-8-phosphanyl-1,9-diazaspiro[4.5]dec-6-en-2-one |
|---|---|
| PubChem CID | 70908618 |
| Molecular Formula | C19H24F3N2O2P |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (5R,8S)-8-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-8-phosphanyl-1,9-diazaspiro[4.5]dec-6-en-2-one |
| SMILES | Cc1cc([C@@H](C)OC[C@@]2(P)C=C[C@]3(CCC(=O)N3)CN2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F3N2O2P/c1-12-7-14(9-15(8-12)19(20,21)22)13(2)26-11-18(27)6-5-17(10-23-18)4-3-16(25)24-17/h5-9,13,23H,3-4,10-11,27H2,1-2H3,(H,24,25)/t13-,17-,18+/m1/s1 |
| InChIKey | ILGURJFDRUNMRV-XWIAVFTESA-N |
| XLogP | 3.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|