C25H27F3N2O2 — CID 70908805
(5R,8S)-8-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-8-phenyl-1,9-diazaspiro[4.5]dec-6-en-2-one (PubChem CID 70908805) has the molecular formula C25H27F3N2O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is (5R,8S)-8-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-8-phenyl-1,9-diazaspiro[4.5]dec-6-en-2-one.
| Compound Name | (5R,8S)-8-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-8-phenyl-1,9-diazaspiro[4.5]dec-6-en-2-one |
|---|---|
| PubChem CID | 70908805 |
| Molecular Formula | C25H27F3N2O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (5R,8S)-8-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-8-phenyl-1,9-diazaspiro[4.5]dec-6-en-2-one |
| SMILES | Cc1cc([C@@H](C)OC[C@@]2(c3ccccc3)C=C[C@]3(CCC(=O)N3)CN2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H27F3N2O2/c1-17-12-19(14-21(13-17)25(26,27)28)18(2)32-16-24(20-6-4-3-5-7-20)11-10-23(15-29-24)9-8-22(31)30-23/h3-7,10-14,18,29H,8-9,15-16H2,1-2H3,(H,30,31)/t18-,23-,24-/m1/s1 |
| InChIKey | XXIMVPLIQPBBTA-DQMJNTIXSA-N |
| XLogP | 4.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|